English

Balance the following chemical equation and identify the type of chemical reaction. CaOsSiOsCaSiosCaO(s)+SiO2(s)→CaSio3(s) - Science

Advertisements
Advertisements

Question

Balance the following chemical equation and identify the type of chemical reaction.

`"CaO"("s") + "SiO"_2("s") -> "CaSio"_3("s")`

One Line Answer

Solution

Equation is already balanced; - Combintion reaction

shaalaa.com
  Is there an error in this question or solution?
Chapter 1: Chemical Reactions and Equations - Exemplar [Page 7]

APPEARS IN

NCERT Exemplar Science [English] Class 10
Chapter 1 Chemical Reactions and Equations
Exemplar | Q 35. (e) | Page 7

RELATED QUESTIONS

Write the balanced chemical equation for the following and identify the type of reaction.

\[\ce{Hydrogen(g) + Chlorine(g) -> Hydrogen chloride (g)}\]


Gas A, which is the major cause of global warming, combines with hydrogen oxide B in nature in the presence of an environmental factor C and a green material D to form a six carbon organic compounds E and a gas F. The gas F is necessary for breathing.
(a) What is gas A?
(b) What is the common name of B?
(c) What do you think could be C?
(d) What is material D? Where is it found?
(e) Name the organic compound E.
(f) What is gas F? Name the natural process during which it is released.


What type of reaction is represented by the following equation?

2 Ca + O2 → 2CaO


Define a combination reaction.


A student prepared an aqueous solution of CuSO4 in beaker X and an aqueous solution of FeSO4 in beaker Y. He then dropped some iron pieces in beaker X and some zinc pieces in beaker Y. After about 10 hours he observed that the solutions in X and Y respectively appear:

(A) blue and green

(B) colourless and pale green

(C) colourless and light blue

(D) greenish and colourless


Classify the following reaction into different type:

CaO(s) + H2O(l) → Ca(OH)2(aq)


Select the correct answer for the statement given below:

The product formed during direct combination reaction of carbon dioxide and water.


Which changes occur during chemical changes?


The respiration process during which glucose undergoes slow combustion by combining with oxygen in the cells of our body to produce energy is a kind of:


Balance the following chemical equation and identify the type of chemical reaction.

`"Mg"("s") + "Cl"_2("g") -> "MgCl"_2("s")`


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×