Advertisements
Advertisements
प्रश्न
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
उत्तर
\[\ce{\underset{Ethylbromide}{C2H5Br} + \underset{Sodium methoxide}{NaOCH3} ->[Δ] \underset{Ethyl methyl ether}{C2H5 - O - CH3} + NaBr}\]
APPEARS IN
संबंधित प्रश्न
Write the structure of 3-methyl butanal
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2CH2CHO
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
OHCC6H4CHO-p
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
is
Write IUPAC name of the following compound:
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
Write the structure of the following compound:
Di-sec. butyl ketone
