Advertisements
Advertisements
प्रश्न
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
उत्तर
APPEARS IN
संबंधित प्रश्न
Compound having general formula is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give IUPAC names of the following compound:
Give the IUPAC names of the following compounds.
Write IUPAC names of the following structures.
Write IUPAC names of the following structures.
Arrange the following in decreasing order of their acidic strength and give reason for your answer.
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
The correct IUPAC name for the given molecule should be
Which of the following I.U.P.A.C. name for (CH3)2CH – CH2 – CH2Br is correct?
is
What is the IUPAC name of the following compound?
Using IUPAC norms write the formulas for the following:
Pentaamminenitrito-N-Cobalt (III)
Using IUPAC norms write the formulas for the following:
Tetrahydroxidozincate (II)
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
Predict the products (name and structure) in the following reaction:
Write the structure of the following compound.
Di-sec. butyl ketone
Draw structures of the following derivatives
AcetaldehydedimethylacetalACe
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec. butyl ketone