मराठी
महाराष्ट्र राज्य शिक्षण मंडळएचएससी विज्ञान (सामान्य) इयत्ता १२ वी

Write the truth value of the following statement: ∃ n ∈ N such that n + 5 > 10. - Mathematics and Statistics

Advertisements
Advertisements

प्रश्न

Write the truth value of the following statement:

∃ n ∈ N such that n + 5 > 10.

बेरीज

उत्तर

∃ n ∈ N, such that n + 5 > 10  is a true statement, hence its truth value is T.
(All n 6, where n ∈ N, satisfy n + 5 > 10).

shaalaa.com
  या प्रश्नात किंवा उत्तरात काही त्रुटी आहे का?
पाठ 1: Mathematical Logic - Miscellaneous Exercise 1 [पृष्ठ ३३]

APPEARS IN

बालभारती Mathematics and Statistics 1 (Arts and Science) [English] 12 Standard HSC Maharashtra State Board
पाठ 1 Mathematical Logic
Miscellaneous Exercise 1 | Q 3.3 | पृष्ठ ३३

व्हिडिओ ट्यूटोरियलVIEW ALL [1]

संबंधित प्रश्‍न

Write truth values of the following statements: ∃ n ∈ N such that n + 5 > 10.


State which of the following is the statement. Justify. In case of a statement, state its truth value.

Please get me breakfast.


State which of the following is the statement. Justify. In case of a statement, state its truth value.

Congruent triangles are similar.


Write the truth values of the following.

64 is a perfect square and 46 is a prime number.


Write the truth values of the following.

5 is a prime number and 7 divides 94.


If the statement p, q are true statement and r, s are false statement then determine the truth value of the following:

(p → q) ∨ (r → s)


If the statement p, q are true statement and r, s are false statement then determine the truth value of the following:

(p → q) ∧ ∼ r


If the statement p, q are true statement and r, s are false statement then determine the truth value of the following:

(∼ r ↔ p) → ∼ q


If A = {3, 5, 7, 9, 11, 12}, determine the truth value of the following.

∃ x ∈ A such that x – 8 = 1


If A = {3, 5, 7, 9, 11, 12}, determine the truth value of the following.

∀ x ∈ A, x is an even number.


If p ∧ q is F, p → q is F then the truth values of p and q are ________.


If A = {1, 2, 3, 4, 5} then which of the following is not true?


Which of the following sentence is the statement in logic? Justify. Write down the truth value of the statement:

4! = 24.


Which of the following sentence is the statement in logic? Justify. Write down the truth value of the statement:

π is an irrational number.


Which of the following sentence is the statement in logic? Justify. Write down the truth value of the statement:

Please get me a glass of water.


Write the truth value of the following statement:

The square of any even number is odd or the cube of any odd number is odd.


State which of the following sentence is a statement. Justify your answer if it is a statement. Write down its truth value.

Please grant me a loan.


State which of the following sentence is a statement. Justify your answer if it is a statement. Write down its truth value.

He is an actor.


State which of the following sentence is a statement. Justify your answer if it is a statement. Write down its truth value.

Have a cup of cappuccino.


State which of the following sentence is a statement. Justify your answer if it is a statement. Write down its truth value.

(x + y)2 = x2 + 2xy + y2 for all x, y ∈ R. 


State which of the following sentence is a statement. Justify your answer if it is a statement. Write down its truth value.

Every real number is a complex number.


State which of the following sentence is a statement. Justify your answer if it is a statement. Write down its truth value.

1 is a prime number.


State which of the following sentence is a statement. Justify your answer if it is a statement. Write down its truth value.

The number π is an irrational number.


Choose the correct alternative :

Which of the following is an open statement?


The negation of the proposition “If 2 is prime, then 3 is odd”, is ______ 


Choose the correct alternative :

The statement (∼ p ∧ q) ∨∼ q is


Choose the correct alternative :

If p is the sentence ‘This statement is false’ then


Choose the correct alternative :

Conditional p → q is equivalent to


If p ∨ q is true then truth value of ∼ p ∨ ∼ q is ______.


Fill in the blanks :

Truth value of if x = 2, then x2 = − 4 is –––––––––.


Fill in the blanks :

p ↔ q is false when p and q have ––––––––– truth values.


Fill in the blanks :

Let p : the problem is easy. r : It is not challenging then verbal form of ∼ p → r is –––––––––.


Fill in the blanks :

Truth value of 2 + 3 = 5 if and only if − 3 > − 9 is –––––––––.


State whether the following statement is True or False :

Truth value of 2 + 3 < 6 is F.


State whether the following statement is True or False :

There are 24 months in year is a statement.


State whether the following statement is True or False :

Truth value of 5 is not an irrational number is T.


State whether the following statement is True or False :

p ∧ t = p.


Solve the following :

State which of the following sentences are statements in logic.
Ice cream Sundaes are my favourite.


Solve the following :

State which of the following sentences are statements in logic.
(a + b)2 = a2 + 2ab + b2 for all a, b ∈ R.


Solve the following :

State which of the following sentences are statements in logic.
All integers are natural numbers.


Which of the following sentence is a statement? In case of a statement, write down the truth value.

Please carry out my instruction.


Which of the following sentence is a statement? In case of a statement, write down the truth value.

The Himalayas is the highest mountain range.


Which of the following sentence is a statement? In case of a statement, write down the truth value.

What are the causes of rural unemployment?


Which of the following sentence is a statement? In case of a statement, write down the truth value.

0! = 1


Assuming the following statement.
p : Stock prices are high.
q : Stocks are rising.
to be true, find the truth value of the following.

Stock prices are not high or stocks are rising.


If p, q, r are statements with truth values T, T, F respectively determine the truth values of the following.

(p ∧ ∼ q) ∨ (∼ p ∧ q)


If p, q, r are statements with truth values T, T, F respectively determine the truth values of the following.

∼ (p ∧ q) → ∼ (q ∧ p)


If A = {2, 3, 4, 5, 6, 7, 8}, determine the truth value of the following statement.

∃ x ∈ A, such that 3x + 2 > 9


If A = {2, 3, 4, 5, 6, 7, 8}, determine the truth value of the following statement.

∀ x ∈ A, x2 + 2 ≥ 5.


State the truth Value of x2 = 25


If statements p, q are true and r, s are false, determine the truth values of the following.

~ p ∧ (q ∨ ~ r)


State whether the following statement is True or False:

Truth value of 3 is not an irrational number is F


State whether the following statement is True or False:

(p ˅ q) ˄ ~ p is a contradiction


State whether the following statement is True or False:

Mathematical identities are true statements


State whether the following statement is True or False:

p ˅ ~ p ≡ ~ c


The truth value of negation of “London is in England” is ______


Given following statements
p: 9 × 5 = 45
q: Pune is in Maharashtra
r: 3 is the smallest prime number

Write truth values by activity

i) (p ˄ q) ˄ r = ( ˄ ) ˄

= ˄

=

ii) ~ ( p ˄ r ) = ( ˄ )

=

=

iii) p → q =

=


Which of the following quantified statement is true?


If (p ∧ ~ q) → ~ p is false, the truth values of p and q are respectively.


If the truth value of statement (q ∧ ~ r) → p is false (F), then the truth values of the statements p, q, rare respectively.


If p (p ∧ ∼q) is false, then the truth values of p and q are respectively ______.


Consider the following two statements.

Statement p:

The value of sin 120° can be divided by taking θ = 240° in the equation 2 sin θ2 = 1+sinθ-1-sinθ.

Statement q:

The angles A, B, C and D of any quadrilateral ABCD satisfy the equation cos(12(A+C))+cos(12(B+D)) = 0

Then the truth values of p and q are respectively.


If p : Every square is a rectangle. q : Every rhombus is a kite, then truth values of p q and p q are ______ and ______ respectively.


Using truth table prove that:

p(qr)(pq)(pr)


Find the truth value of the following compound statement:

5 + 4 = 9 and 6 × 3 = 12


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×
Our website is made possible by ad-free subscriptions or displaying online advertisements to our visitors.
If you don't like ads you can support us by buying an ad-free subscription or please consider supporting us by disabling your ad blocker. Thank you.