Advertisements
Advertisements
प्रश्न
Give IUPAC name of :
उत्तर
IUPAC name :
2-methyl -1-butanal
APPEARS IN
संबंधित प्रश्न
How are ketones classified?
Write the structure of 3-methyl butanal
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
OHCC6H4CHO-p
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
IUPAC name of CH3CHO is ____________.
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
Prop-2-enal is called ____________.
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
Write the IUPAC name for the following organic compound:
The IUPAC name of neopentane is
What is the IUPAC name of the following compound?
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
Write IUPAC name of the following compound:
Using IUPAC norms write the formulas for the following:
Tetrahydroxidozincate (II)
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound.
Di-sec. butyl ketone
