Advertisements
Advertisements
प्रश्न
Give IUPAC name of :
उत्तर
IUPAC name :
2-methyl -1-butanal
APPEARS IN
संबंधित प्रश्न
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
The following compound is called:
CH3CH(OCH3)CHO is called:
Write IUPAC names of the following structures.
is
The correct IUPAC name of the following compound is:
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Write the IUPAC name of the following complex:
K2[PdCl4]
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Using IUPAC norms write the formulas for the following:
Pentaamminenitrito-N-Cobalt (III)
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
Convert the following:
Bromobenzene to benzoic acid
Write the structure of the following compound:
Di-sec-butyl ketone
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
Write the structure of the following compound.
Di-sec. butyl ketone
