हिंदी
कर्नाटक बोर्ड पी.यू.सी.पीयूसी विज्ञान 2nd PUC Class 12

Label the hydrophilic and hydrophobic parts in the following compounds: CH3(CH2)16COO(CH2CH2O)nCH2CH2OH - Chemistry

Advertisements
Advertisements

प्रश्न

Label the hydrophilic and hydrophobic parts in the following compounds.

`CH_3(CH_2)_16COO(CH_2CH_2O)_nCH_2CH_2OH`

उत्तर

shaalaa.com
  क्या इस प्रश्न या उत्तर में कोई त्रुटि है?
अध्याय 16: Chemistry in Everyday Life - Exercises [पृष्ठ ४५५]

APPEARS IN

एनसीईआरटी Chemistry [English] Class 12
अध्याय 16 Chemistry in Everyday Life
Exercises | Q 27.3 | पृष्ठ ४५५

संबंधित प्रश्न

Explain the following terms with suitable examples - Non-ionic detergents


What are biodegradable and non-biodegradable detergents? Give one example of each.


Label the hydrophilic and hydrophobic parts in the following compounds.

CH3(CH2)10CH2OSO3 Na+


What are anionic detergents? Give an example ?


What type of detergents are used in toothpaste? 


What type of detergent are used in toothpastes?


Define the following term with a suitable example in each:
Cationic detergents


Which of the following statements are correct?

(i) Cationic detergents have germicidal properties.

(ii) Bacteria can degrade the detergents containing highly branched chains.

(iii) Some synthetic detergents can give foam even in ice cold water.

(iv) Synthetic detergents are not soaps.


Dishwashing soaps are synthetic detergents. What is their chemical nature?


How does the branching of hydrocarbon chain of synthetic detergents affect their biodegradability?


Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimised? Classify the detergents according to their chemical nature.


Explain the following term with suitable example.

Cationic detergents


Explain the following term with suitable examples.

cationic detergents


Explain the following term with a suitable example.

cationic detergents


Explain the following term with suitable examples.

Cationic detergents


Explain the Following Term with Suitable Examples.

Cationic Detergents


Explain the following term with a suitable example:

Cationic detergents


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×