Advertisements
Advertisements
प्रश्न
Name the following compound according to IUPAC system of nomenclature:
OHCC6H4CHO-p
उत्तर
Benzene-1, 4-dicarbaldehyde
APPEARS IN
संबंधित प्रश्न
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Give IUPAC name of :
The following compound is called:
CH3CH(OCH3)CHO is called:
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
The correct IUPAC name of the following compound is:
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Name the following compounds according to the IUPAC system of nomenclature:
\[\ce{(CH3)3CCH2COOH}\]
Predict the products (name and structure) in the following reaction:
\[\ce{C6H5 - CH2 - CH3 ->[alk. KMnO4][\Delta]}\] ?
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
