Advertisements
Advertisements
प्रश्न
Write two uses of formaldehyde
उत्तर
Uses of formaldehyde:
a) Formalin (40% solution of formaldehyde) is used as preservative for biological specimens
b) Formaldehyde is used for silvering mirror.
c) Formaldehyde is used for the production of several plastic and resins, bakelite
and binders in plywood.
APPEARS IN
संबंधित प्रश्न
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Name the following compound according to IUPAC system of nomenclature:
CH3CH=CHCHO
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
Give IUPAC names of the following compound:
CH3CH(OCH3)CHO is called:
Write IUPAC names of the following structures.
Write IUPAC names of the following structures.
Arrange the following in decreasing order of their acidic strength and give reason for your answer.
\[\ce{CH3CH2OH, CH3COOH, ClCH2COOH, FCH2COOH, C6H5CH2COOH}\]
The correct IUPAC name for the given molecule should be
\[\begin{array}{cc}
\ce{H3C - \overset{H}{C} - \overset{H2}{C} - \overset{H}{C} - OH}\\
\phantom{.}|\phantom{.........}|\phantom{}\\
\phantom{...}\ce{CH3}\phantom{......}\ce{CH3}\phantom{}
\end{array}\]
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
The correct IUPAC name of the following compound is:
IUPAC name of following compound is:
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
Write IUPAC name of the following compound:
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Write the structure of the following compound:
Di-sec-butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{C6H5 - CH2 - CH3 ->[alk. KMnO4][\Delta]}\] ?
Write the structure of the following compound:
Di-sec-butyl ketone
