Advertisements
Advertisements
प्रश्न
Which of the following enhances leathering property of soap?
विकल्प
Sodium carbonate
Sodium rosinate
Sodium stearate
Trisodium phosphate
उत्तर
Sodium rosinate
Explanation:
Shaving soaps contain glycerol to prevent rapid drying. A gum called rosin is added in these soaps which forms sodium rosinate which enhances lathering property of soap.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Why is bithional added to soap?
Why do soaps not work in hard water?
Explain the cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
What is the side product of soap industry? Give reactions showing soap formation.
How are transparent soaps manufactured?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Self-cleansing windows are example of the ______.
