हिंदी

Write Balanced Chemical Equations for the Action of Hydrogen Bromide on Styrene in the Presence of a Peroxide - Chemistry

Advertisements
Advertisements

प्रश्न

Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide

संक्षेप में उत्तर

उत्तर

Balance equation is
\[\ce{\underset{\text{styrene}}{C6H5CH} = CH2 + HBr ->[Peroxide] C6H5CH2 - CH2Br }\]

shaalaa.com
  क्या इस प्रश्न या उत्तर में कोई त्रुटि है?
2012-2013 (March)

APPEARS IN

संबंधित प्रश्न

Explain cationic detergents.


Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.

(C15H31COO)3C3H5 – Glyceryl palmitate


Why do soaps not work in hard water?


Can you use soaps and synthetic detergents to check the hardness of water?


Explain the cleansing action of soaps.


Explain the mechanism of cleansing action of soaps.


Write balanced chemical equations for the action of methyl bromide on silver propanoate


How soap is prepared?


Which of the following enhances leathering property of soap?


Glycerol is added to soap. It functions ______.


Why is it safer to use soap from the environmental point of view?


How are transparent soaps manufactured?


What are fillers and what role these fillers play in soap?


Match the soaps given in Column I with items given in Column II.

Column I Column II
(i) Soap chips (a) dried miniature soap bubbles
(ii) Soap granules (b) small broken pieces of soap formed from melted soaps
(iii) Soap powder (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\]
(iv) Scouring soap (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\]

Match the detergents given in Column I with their uses given in Column II.

Column I Column II
(i)  (a) Dishwashing powder
(ii)  (b) Laundry soap
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] (c) Hair conditioners
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] (d) Toothpaste

Assertion: Transparent soaps are made by dissolving soaps in ethanol.

Reason: Ethanol makes things invisible.


Which of the following is not a correct statement?


Green chemistry in day-to-day life is in the use of ______.


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×