Advertisements
Advertisements
प्रश्न
What is the side product of soap industry? Give reactions showing soap formation.
उत्तर
Glycerol is obtained as a side product during the formation of soaps.
The process of soap formation is referred as saponification. It is the process that involves the conversion of fat or oil into soap and alcohol by action of heat in the presence of aqueous alkali.
\[\begin{array}{cc}
\ce{O}\phantom{..........................................}\\
||\phantom{..........................................}\\
\phantom{.}\ce{CH2 - O - \underset{}{C} - C17H35}\phantom{..................................}\ce{CH2 - OH}\phantom{.}\\
\phantom{..}|\phantom{..........}\ce{O}\phantom{............................................}|\phantom{..........}\\
|\phantom{..........}||\phantom{.....................................................}\\
\phantom{}\ce{CH - O - C - C17H35 + \underset{hydroxide}{\underset{Sodium}{3NaOH}} -> \underset{sterate}{\underset{Sodium}{3C17H35COONa}} + CH - OH}\phantom{.}\\
\phantom{..}|\phantom{..........}\ce{O}\phantom{............................................}|\phantom{..........}\\
|\phantom{..........}||\phantom{.....................................................}\\
\phantom{.}\ce{\underset{of stearic acid (Fat)}{\underset{Glyceryl ester}{CH2 - O - C - C17H35}}\phantom{...................................}\ce{\underset{(or Glycerine)}{\underset{Glycerol}{CH2 - OH}}}\phantom{}}
\end{array}\]
APPEARS IN
संबंधित प्रश्न
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Can you use soaps and synthetic detergents to check the hardness of water?
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Write balanced chemical equations for the action of methyl bromide on silver propanoate
Glycerol is added to soap. It functions ______.
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
What is the difference between bathing soap and washing soaps?
Match the detergents given in Column I with their uses given in Column II.
Column I | Column II |
(i) ![]() |
(a) Dishwashing powder |
(ii) ![]() |
(b) Laundry soap |
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Self-cleansing windows are example of the ______.