Advertisements
Advertisements
Question
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Solution
Functional groups present in the molecule are:
(i) Ether, and
(ii) primary alcoholic group
APPEARS IN
RELATED QUESTIONS
Explain cationic detergents.
Why is bithional added to soap?
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Write balanced chemical equations for the action of methyl bromide on silver propanoate
Glycerol is added to soap. It functions ______.
Why is it safer to use soap from the environmental point of view?
What is the side product of soap industry? Give reactions showing soap formation.
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.
