Advertisements
Advertisements
प्रश्न
Why do soaps not work in hard water?
उत्तर
Soaps are sodium or potassium salts of long-chain fatty acids. Hard water contains calcium and magnesium ions. When soaps are dissolved in hard water, these ions displace sodium or potassium from their salts and form insoluble calcium or magnesium salts of fatty acids. These insoluble salts separate as scum.
`2C_17H_35COONa + CaCl -> 2NaCl + (C_17H_35COO)_2Ca`
Soap Insiluable calcium Stearate(Soap)
This is the reason why soaps do not work in hard water.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Why is bithional added to soap?
What is a soap ?
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Glycerol is added to soap. It functions ______.
Why is it safer to use soap from the environmental point of view?
What is the difference between bathing soap and washing soaps?
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Which of the following is not a correct statement?
Green chemistry in day-to-day life is in the use of ______.
