Advertisements
Advertisements
प्रश्न
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
उत्तर
APPEARS IN
संबंधित प्रश्न
Why is bithional added to soap?
What is a soap ?
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Why do soaps not work in hard water?
Explain the cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Write balanced chemical equations for the action of methyl bromide on silver propanoate
What is a soft soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
Why is it safer to use soap from the environmental point of view?
What is the side product of soap industry? Give reactions showing soap formation.
What is the difference between bathing soap and washing soaps?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.
